cas: 1375064-46-2 — see every product listed under this CAS number, including other names
Methyl 5-(3-Pyridyl)isoxazole-3-carboxylate, 97+%, 97+% (CAS 1375064-46-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124DY-100mg |
| cas | 1375064-46-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 746.00 Pln |
| purity | 97+% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-pyridin-3-yl-1,2-oxazole-3-carboxylate (CAS 1375064-46-2) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 5-pyridin-3-yl-1,2-oxazole-3-carboxylate. InChIKey: IJYBKCVFGWEEKG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 5-pyridin-3-yl-1,2-oxazole-3-carboxylate |
| InChIKey | IJYBKCVFGWEEKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)