cas: 530145-59-6 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2,3,4-trifluorobenzoate, 95%, 95% (CAS 530145-59-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K0AN-1g |
| cas | 530145-59-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 357.20 Pln | |
| Chemat | 25g | 2920.40 Pln | |
| Chemat | 5g | 928.40 Pln | |
| Chemat | 10g | 1494.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-2,3,4-trifluorobenzoate (CAS 530145-59-6) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: methyl 5-bromo-2,3,4-trifluorobenzoate. InChIKey: GJVMADPTUUTJOF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | methyl 5-bromo-2,3,4-trifluorobenzoate |
| InChIKey | GJVMADPTUUTJOF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)Br |
Computed by PubChem (NCBI)