cas: 57381-59-6 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-fluorobenzoate 98% (CAS 57381-59-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A223807-1g |
| cas | 57381-59-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 693.00 Pln | |
| Ambeed | 500g | 3179.44 Pln | |
| Ambeed | 1000g | 5359.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A223807 |
Methyl 5-bromo-2-fluorobenzoate (CAS 57381-59-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: methyl 5-bromo-2-fluorobenzoate. InChIKey: DXOPSTSVRPCTOS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | methyl 5-bromo-2-fluorobenzoate |
| InChIKey | DXOPSTSVRPCTOS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)