Products 57381-59-6
CAS 57381-59-6 appears in our catalog under these names: Methyl 5–Bromo–2–Fluorobenzoate, 5-Bromo-2-fluorobenzoic acid methyl ester, Methyl 5-bromo-2-fluorobenzoate 98%, Methyl 5-bromo-2-fluorobenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 50g, 1g, 10g, 100g, 500g, 1000g.
Methyl 5-bromo-2-fluorobenzoate (CAS 57381-59-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: methyl 5-bromo-2-fluorobenzoate. InChIKey: DXOPSTSVRPCTOS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | methyl 5-bromo-2-fluorobenzoate |
| InChIKey | DXOPSTSVRPCTOS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)