Methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate, 95%
cas: 1131587-92-2 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate, 95% (CAS 1131587-92-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A154144-1g |
| cas | 1131587-92-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1944.56 Pln | |
| Ambeed | 5g | 5682.56 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 2037.20 Pln | |
| Chemat | 5g | 5982.80 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 775.31 Pln | |
| BLDpharm | 1g | 2091.51 Pln | |
| BLDpharm | 5g | 6123.42 Pln | |
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1330.80 Pln | |
| Fluorochem | 1g | 3767.44 Pln | |
| Fluorochem | 5g | 10910.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate (CAS 1131587-92-2) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate. InChIKey: ZFAKQPQSRXDSBA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate |
| InChIKey | ZFAKQPQSRXDSBA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)C(F)(F)F)Br |
Computed by PubChem (NCBI)