Products 1131587-92-2
CAS 1131587-92-2 is the registry number for Methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate (CAS 1131587-92-2) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate. InChIKey: ZFAKQPQSRXDSBA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 5-bromo-2-hydroxy-4-(trifluoromethyl)benzoate |
| InChIKey | ZFAKQPQSRXDSBA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)C(F)(F)F)Br |
Computed by PubChem (NCBI)