cas: 174261-01-9 — see every product listed under this CAS number, including other names
Methyl 5-chloro-2,4-dimethoxybenzoate (CAS 174261-01-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629120-1G |
| cas | 174261-01-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1955.58 Pln | |
| Fluorochem | 5g | 5719.88 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 5-chloro-2,4-dimethoxybenzoate (CAS 174261-01-9) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: methyl 5-chloro-2,4-dimethoxybenzoate. InChIKey: CYBZPSKAYVKEEA-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | methyl 5-chloro-2,4-dimethoxybenzoate |
| InChIKey | CYBZPSKAYVKEEA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)Cl)OC |
Computed by PubChem (NCBI)