cas: 27383-91-1 — see every product listed under this CAS number, including other names
Methyl 5-methylbenzo[d]oxazole-2-carboxylate, 95%, 95% (CAS 27383-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BI0K-100mg |
| cas | 27383-91-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1974.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-methyl-1,3-benzoxazole-2-carboxylate (CAS 27383-91-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 5-methyl-1,3-benzoxazole-2-carboxylate. InChIKey: XHWXWKQFZDJTOE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 5-methyl-1,3-benzoxazole-2-carboxylate |
| InChIKey | XHWXWKQFZDJTOE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=N2)C(=O)OC |
Computed by PubChem (NCBI)