cas: 153559-93-4 — see every product listed under this CAS number, including other names
Methyl 6-acetylnicotinate, 95%, 95% (CAS 153559-93-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY66-100mg |
| cas | 153559-93-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 2229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-acetylpyridine-3-carboxylate (CAS 153559-93-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 6-acetylpyridine-3-carboxylate. InChIKey: GORGQDZBRJIMDB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 6-acetylpyridine-3-carboxylate |
| InChIKey | GORGQDZBRJIMDB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)