cas: 364385-64-8 — see every product listed under this CAS number, including other names
Methyl cis-4-(Boc-amino)cyclohexanecarboxylate, 97% (CAS 364385-64-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F984675-1G |
| cas | 364385-64-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 518.59 Pln | |
| Fluorochem | 10g | 976.76 Pln | |
| Fluorochem | 25g | 1851.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 364385-64-8) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: RKOQMDUDKCMVFW-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | RKOQMDUDKCMVFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C(=O)OC |
Computed by PubChem (NCBI)