cas: 364385-64-8 — see every product listed under this CAS number, including other names
cis-Methyl 4-((tert-butoxycarbonyl)amino)cyclohexanecarboxylate, 98%, 98% (CAS 364385-64-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D6HU-250mg |
| cas | 364385-64-8 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1763.60 Pln | |
| Chemat | 100g | 4062.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 364385-64-8) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: RKOQMDUDKCMVFW-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | RKOQMDUDKCMVFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C(=O)OC |
Computed by PubChem (NCBI)