cas: 1187927-40-7 — see every product listed under this CAS number, including other names
Methyl indoline-4-carboxylate hydrochloride 97% (CAS 1187927-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A740148-100mg |
| cas | 1187927-40-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A740148 |
Methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride (CAS 1187927-40-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride. InChIKey: SBSHOJQKDISHLU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride |
| InChIKey | SBSHOJQKDISHLU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CCNC2=CC=C1.Cl |
Computed by PubChem (NCBI)