cas: 1187927-40-7 — see every product listed under this CAS number, including other names
2,3-Dihydro-1H-indole-4-carboxylic acid methyl ester hydrochloride, 97%, 97% (CAS 1187927-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119XKW-100mg |
| cas | 1187927-40-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1576.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride (CAS 1187927-40-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride. InChIKey: SBSHOJQKDISHLU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride |
| InChIKey | SBSHOJQKDISHLU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CCNC2=CC=C1.Cl |
Computed by PubChem (NCBI)