cas: 1187927-40-7 — see every product listed under this CAS number, including other names
Methyl indoline-4-carboxylate hydrochloride, 95% (CAS 1187927-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F460664-100MG |
| cas | 1187927-40-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2283.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride (CAS 1187927-40-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride. InChIKey: SBSHOJQKDISHLU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride |
| InChIKey | SBSHOJQKDISHLU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CCNC2=CC=C1.Cl |
Computed by PubChem (NCBI)