cas: 141452-01-9 — see every product listed under this CAS number, including other names
Methyl indoline-5-carboxylate 98% (CAS 141452-01-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147635-100mg |
| cas | 141452-01-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 10g | 887.69 Pln | |
| Ambeed | 25g | 1672.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A147635 |
Methyl 2,3-dihydro-1H-indole-5-carboxylate (CAS 141452-01-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-5-carboxylate. InChIKey: VVAPQJBMJBCZMH-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-5-carboxylate |
| InChIKey | VVAPQJBMJBCZMH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)