cas: 1187928-05-7 — see every product listed under this CAS number, including other names
Methyl indoline-6-carboxylate hydrochloride, 97% (CAS 1187928-05-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F445904-250MG |
| cas | 1187928-05-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 500mg | 502.97 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 2.5g | 1237.08 Pln | |
| Fluorochem | 5g | 1695.25 Pln | |
| Fluorochem | 10g | 3340.51 Pln | |
| Fluorochem | 25g | 8250.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride (CAS 1187928-05-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride. InChIKey: YRVKTOXGFFZLCT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
| InChIKey | YRVKTOXGFFZLCT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCN2)C=C1.Cl |
Computed by PubChem (NCBI)