cas: 154650-88-1 — see every product listed under this CAS number, including other names
Methyl thieno[2,3-b]pyridine-2-carboxylate, 98% (CAS 154650-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F721744-100MG |
| cas | 154650-88-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 971.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl thieno[2,3-b]pyridine-2-carboxylate (CAS 154650-88-1) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: methyl thieno[2,3-b]pyridine-2-carboxylate. InChIKey: SUHXBEISAFXKIN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | methyl thieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | SUHXBEISAFXKIN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)N=CC=C2 |
Computed by PubChem (NCBI)