cas: 253332-81-9 — see every product listed under this CAS number, including other names
Methyl thieno[2,3-c]pyridine-5-carboxylate, 95%, 95% (CAS 253332-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CGVJ-100mg |
| cas | 253332-81-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2474.00 Pln | |
| Chemat | 1g | 4888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl thieno[2,3-c]pyridine-5-carboxylate (CAS 253332-81-9) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: methyl thieno[2,3-c]pyridine-5-carboxylate. InChIKey: UJWDXLCZHGRIDS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | methyl thieno[2,3-c]pyridine-5-carboxylate |
| InChIKey | UJWDXLCZHGRIDS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C2C(=C1)C=CS2 |
Computed by PubChem (NCBI)