cas: 120635-25-8 — see every product listed under this CAS number, including other names
Mofegiline (hydrochloride), 99.57% (CAS 120635-25-8) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 5 mg, 25 mg, 10 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-16677A-10mM/1mL |
| cas | 120635-25-8 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 1132.39 Pln | |
| MedChemExpress | 100 mg | 7699.01 Pln | |
| MedChemExpress | 5 mg | 1039.51 Pln | |
| MedChemExpress | 25 mg | 3073.58 Pln | |
| MedChemExpress | 10 mg | 1596.79 Pln | |
| MedChemExpress | 50 mg | 4856.88 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.57% |
(2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine;hydrochloride (CAS 120635-25-8) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: (2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine;hydrochloride. InChIKey: QUCNNQHLIHGBIA-HCUGZAAXSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | (2E)-2-(fluoromethylidene)-4-(4-fluorophenyl)butan-1-amine;hydrochloride |
| InChIKey | QUCNNQHLIHGBIA-HCUGZAAXSA-N |
| SMILES | C1=CC(=CC=C1CC/C(=C\F)/CN)F.Cl |
Computed by PubChem (NCBI)