cas: 366-29-0 — see every product listed under this CAS number, including other names
N,N,N',N'-Tetramethylbenzidine, 97.5% (CAS 366-29-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 138380050 |
| cas | 366-29-0 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 438.76 Pln | |
| Thermo Scientific (Acros) | 25g | 1527.88 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97.5% |
4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline (CAS 366-29-0) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline. InChIKey: YRNWIFYIFSBPAU-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline |
| InChIKey | YRNWIFYIFSBPAU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)