cas: 366-29-0 — see every product listed under this CAS number, including other names
N,n,n,n-tetramethylbenzidine, 97%, 97% (CAS 366-29-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SGR-100mg |
| cas | 366-29-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 10g | 798.80 Pln | |
| Chemat | 25g | 1538.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline (CAS 366-29-0) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline. InChIKey: YRNWIFYIFSBPAU-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline |
| InChIKey | YRNWIFYIFSBPAU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)