cas: 349097-65-0 — see every product listed under this CAS number, including other names
N-(2-(Trifluoromethyl)phenyl)-3-chloropropanamide (CAS 349097-65-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 50g, 250mg, 1g, 5g, 10g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FT169185-100g |
| cas | 349097-65-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 100g | price on request | |
| Biosynth | 50g | price on request | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 674.78 Pln | |
| Fluorochem | 10g | 1049.65 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Sourcing |
| purity | No data |
| delivery time | 2-3 weeks |
3-chloro-N-[2-(trifluoromethyl)phenyl]propanamide (CAS 349097-65-0) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: 3-chloro-N-[2-(trifluoromethyl)phenyl]propanamide. InChIKey: XTAFQSKBUBILAB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | 3-chloro-N-[2-(trifluoromethyl)phenyl]propanamide |
| InChIKey | XTAFQSKBUBILAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)NC(=O)CCCl |
Computed by PubChem (NCBI)