CAS 949444-74-0 appears in our catalog under these names: 2-Chloro-n-[2-(trifluoromethyl)phenyl]propanamide, 95%, 2-Chloro-N-(2-(trifluoromethyl)phenyl)propanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10000mg, 5000mg.
2-chloro-N-[2-(trifluoromethyl)phenyl]propanamide (CAS 949444-74-0) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: 2-chloro-N-[2-(trifluoromethyl)phenyl]propanamide. InChIKey: LPZWGHVAKVEFNN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | 2-chloro-N-[2-(trifluoromethyl)phenyl]propanamide |
| InChIKey | LPZWGHVAKVEFNN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=CC=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)