Products 572881-42-6
CAS 572881-42-6 appears in our catalog under these names: 2-Chloro-n-[4-(trifluoromethyl)phenyl]propanamide, 95%, N-(4-Trifluoromethylphenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 50g, 25g.
2-chloro-N-[4-(trifluoromethyl)phenyl]propanamide (CAS 572881-42-6) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: 2-chloro-N-[4-(trifluoromethyl)phenyl]propanamide. InChIKey: FPRVGJQLWPFYOU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | 2-chloro-N-[4-(trifluoromethyl)phenyl]propanamide |
| InChIKey | FPRVGJQLWPFYOU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)