Products 459417-72-2
CAS 459417-72-2 is the registry number for N-(2-Chloro-4,6-dimethylphenyl)-2,2,2-trifluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloro-4,6-dimethylphenyl)-2,2,2-trifluoroacetamide (CAS 459417-72-2) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: N-(2-chloro-4,6-dimethylphenyl)-2,2,2-trifluoroacetamide. InChIKey: GNHGQERRQVPGRT-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | N-(2-chloro-4,6-dimethylphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | GNHGQERRQVPGRT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)NC(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)