Products 2228547-21-3
CAS 2228547-21-3 is the registry number for 3-(4-Chloro-3-(trifluoromethyl)phenoxy)azetidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-chloro-3-(trifluoromethyl)phenoxy]azetidine (CAS 2228547-21-3) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: 3-[4-chloro-3-(trifluoromethyl)phenoxy]azetidine. InChIKey: WPOMMXSUJRBDOC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | 3-[4-chloro-3-(trifluoromethyl)phenoxy]azetidine |
| InChIKey | WPOMMXSUJRBDOC-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)