CAS 349097-65-0 appears in our catalog under these names: 3-Chloro-n-[2-(trifluoromethyl)phenyl]propanamide, 95%, N-(2-(Trifluoromethyl)phenyl)-3-chloropropanamide. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100g, 50g, 250mg.
3-chloro-N-[2-(trifluoromethyl)phenyl]propanamide (CAS 349097-65-0) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: 3-chloro-N-[2-(trifluoromethyl)phenyl]propanamide. InChIKey: XTAFQSKBUBILAB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | 3-chloro-N-[2-(trifluoromethyl)phenyl]propanamide |
| InChIKey | XTAFQSKBUBILAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)NC(=O)CCCl |
Computed by PubChem (NCBI)