Products 101824-35-5
CAS 101824-35-5 is the registry number for 2-Chloro-N-(3-trifluoromethyl-benzyl)-acetamide. Offered by: Fluorochem. Available pack sizes: 500mg.
2-chloro-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide (CAS 101824-35-5) is a chemical compound with the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. IUPAC name: 2-chloro-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide. InChIKey: AFWJINGUGZLWCH-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO |
|---|---|
| Molecular weight | 251.63 g/mol |
| IUPAC name | 2-chloro-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
| InChIKey | AFWJINGUGZLWCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CNC(=O)CCl |
Computed by PubChem (NCBI)