cas: 4424-17-3 — see every product listed under this CAS number, including other names
N-(2-Aminophenyl)benzamide, 97%, 97% (CAS 4424-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GJ7-250mg |
| cas | 4424-17-3 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 2882.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-N-phenylbenzamide (CAS 4424-17-3) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 2-amino-N-phenylbenzamide. InChIKey: FDPVTENMNDHFNK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 2-amino-N-phenylbenzamide |
| InChIKey | FDPVTENMNDHFNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)