cas: 116010-06-1 — see every product listed under this CAS number, including other names
N-(2-BROMO-5-CHLORO-4-METHYLPHENYL)ACETAMIDE, 98% (CAS 116010-06-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F389985-1G |
| cas | 116010-06-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 846.59 Pln | |
| Fluorochem | 100g | 1903.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-bromo-5-chloro-4-methylphenyl)acetamide (CAS 116010-06-1) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: N-(2-bromo-5-chloro-4-methylphenyl)acetamide. InChIKey: QIMHWSBYSKKYFR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | N-(2-bromo-5-chloro-4-methylphenyl)acetamide |
| InChIKey | QIMHWSBYSKKYFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)NC(=O)C)Br |
Computed by PubChem (NCBI)