cas: 116010-06-1 — see every product listed under this CAS number, including other names
N-Acetyl 2-bromo-5-chloro-4-methylaniline, 98%, 98% (CAS 116010-06-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BE7-250mg |
| cas | 116010-06-1 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 323.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(2-bromo-5-chloro-4-methylphenyl)acetamide (CAS 116010-06-1) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: N-(2-bromo-5-chloro-4-methylphenyl)acetamide. InChIKey: QIMHWSBYSKKYFR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | N-(2-bromo-5-chloro-4-methylphenyl)acetamide |
| InChIKey | QIMHWSBYSKKYFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)NC(=O)C)Br |
Computed by PubChem (NCBI)