cas: 64695-81-4 — see every product listed under this CAS number, including other names
N-(2-Bromo-4,5-difluorophenyl)acetamide, 98%, 98% (CAS 64695-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EFNS-100mg |
| cas | 64695-81-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 626.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(2-bromo-4,5-difluorophenyl)acetamide (CAS 64695-81-4) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: N-(2-bromo-4,5-difluorophenyl)acetamide. InChIKey: ZOLGCOUVLFISTP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | N-(2-bromo-4,5-difluorophenyl)acetamide |
| InChIKey | ZOLGCOUVLFISTP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Br)F)F |
Computed by PubChem (NCBI)