cas: 57045-86-0 — see every product listed under this CAS number, including other names
N-(2-Bromo-4-nitrophenyl)acetamide, 98% (CAS 57045-86-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A499284-250mg |
| cas | 57045-86-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 115.57 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1393.28 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-(2-bromo-4-nitrophenyl)acetamide (CAS 57045-86-0) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: N-(2-bromo-4-nitrophenyl)acetamide. InChIKey: CVRYGNVWNQYYEC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | N-(2-bromo-4-nitrophenyl)acetamide |
| InChIKey | CVRYGNVWNQYYEC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)