CAS 90221-50-4 is the registry number for N-(2-Bromo-5-nitrophenyl)acetamide, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N-(2-bromo-5-nitrophenyl)acetamide (CAS 90221-50-4) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: N-(2-bromo-5-nitrophenyl)acetamide. InChIKey: RTSTZQRSWJGBNU-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | N-(2-bromo-5-nitrophenyl)acetamide |
| InChIKey | RTSTZQRSWJGBNU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)