Products 1807208-72-5
CAS 1807208-72-5 appears in our catalog under these names: 4–Bromo–3–methyl–5–nitrobenzamide, 4-Bromo-3-methyl-5-nitrobenzamide, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 10g.
4-bromo-3-methyl-5-nitrobenzamide (CAS 1807208-72-5) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: 4-bromo-3-methyl-5-nitrobenzamide. InChIKey: DAHXBPXTQUXLTK-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 4-bromo-3-methyl-5-nitrobenzamide |
| InChIKey | DAHXBPXTQUXLTK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)