CAS 57045-86-0 appears in our catalog under these names: N-Acetyl 2-bromo-4-nitroaniline, 98%, N-(2-Bromo-4-nitrophenyl)acetamide, 98%, N-Acetyl 2-bromo-4-nitroaniline, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
N-(2-bromo-4-nitrophenyl)acetamide (CAS 57045-86-0) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: N-(2-bromo-4-nitrophenyl)acetamide. InChIKey: CVRYGNVWNQYYEC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | N-(2-bromo-4-nitrophenyl)acetamide |
| InChIKey | CVRYGNVWNQYYEC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)