CAS 3598-91-2 is the registry number for 2-Bromo-N-(4-nitrophenyl)acetamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
2-bromo-N-(4-nitrophenyl)acetamide (CAS 3598-91-2) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: 2-bromo-N-(4-nitrophenyl)acetamide. InChIKey: XSKCUIFGKBMFOW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 2-bromo-N-(4-nitrophenyl)acetamide |
| InChIKey | XSKCUIFGKBMFOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)