CAS 871269-03-3 is the registry number for 2-Acetamido-5-bromoisonicotinic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-acetamido-5-bromopyridine-4-carboxylic acid (CAS 871269-03-3) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: 2-acetamido-5-bromopyridine-4-carboxylic acid. InChIKey: CLUSCTBEWDBHAY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 2-acetamido-5-bromopyridine-4-carboxylic acid |
| InChIKey | CLUSCTBEWDBHAY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(C(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)