Products 1096893-94-5
CAS 1096893-94-5 appears in our catalog under these names: N-Methyl 4-bromo-3-nitrobenzamide, 95%, 4-Bromo-N-methyl-3-nitrobenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
4-bromo-N-methyl-3-nitrobenzamide (CAS 1096893-94-5) is a chemical compound with the molecular formula C8H7BrN2O3 and a molecular weight of 259.06 g/mol. IUPAC name: 4-bromo-N-methyl-3-nitrobenzamide. InChIKey: YWNKGZWXPKMDTH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O3 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 4-bromo-N-methyl-3-nitrobenzamide |
| InChIKey | YWNKGZWXPKMDTH-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)