cas: 100956-66-9 — see every product listed under this CAS number, including other names
N-(3,4-Dimethoxyphenyl)-4-methylbenzenesulfonamide, 95%, 95% (CAS 100956-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120ERD-250mg |
| cas | 100956-66-9 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 563.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(3,4-dimethoxyphenyl)-4-methylbenzenesulfonamide (CAS 100956-66-9) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: N-(3,4-dimethoxyphenyl)-4-methylbenzenesulfonamide. InChIKey: JRAYUPSJGCRNDR-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | N-(3,4-dimethoxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | JRAYUPSJGCRNDR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)