cas: 100956-66-9 — see every product listed under this CAS number, including other names
N-(3,4-Dimethoxyphenyl)-4-methylbenzenesulfonamide, 95-<97% (CAS 100956-66-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1993-95-97-10g |
| cas | 100956-66-9 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3523.52 Pln | |
| Hoffman Fine Chemicals | 25g | 6739.04 Pln | |
| Hoffman Fine Chemicals | 50g | 10598.94 Pln | |
| Hoffman Fine Chemicals | 100g | 16768.40 Pln | |
| Hoffman Fine Chemicals | 200g | 28290.68 Pln | |
| Hoffman Fine Chemicals | 300g | 35984.96 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
N-(3,4-dimethoxyphenyl)-4-methylbenzenesulfonamide (CAS 100956-66-9) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: N-(3,4-dimethoxyphenyl)-4-methylbenzenesulfonamide. InChIKey: JRAYUPSJGCRNDR-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | N-(3,4-dimethoxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | JRAYUPSJGCRNDR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)