cas: 1579-89-1 — see every product listed under this CAS number, including other names
N-(4-Amino-3-(trifluoromethyl)phenyl)acetamide, 98%, 98% (CAS 1579-89-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PTI-1g |
| cas | 1579-89-1 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 688.40 Pln | |
| Chemat | 10g | 362.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[4-amino-3-(trifluoromethyl)phenyl]acetamide (CAS 1579-89-1) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: N-[4-amino-3-(trifluoromethyl)phenyl]acetamide. InChIKey: QMCLCXKXDXBQLB-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | N-[4-amino-3-(trifluoromethyl)phenyl]acetamide |
| InChIKey | QMCLCXKXDXBQLB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)