cas: 188577-70-0 — see every product listed under this CAS number, including other names
N-(4-CHLORO-PYRIDIN-2-YL)-2,2-DIMETHYL-PROPIONAMIDE, 99%, 99% (CAS 188577-70-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113H1J-100mg |
| cas | 188577-70-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 938.00 Pln | |
| Chemat | 250mg | 1341.20 Pln | |
| Chemat | 500mg | 1965.20 Pln | |
| Chemat | 1g | 3088.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-(4-chloro-2-pyridinyl)-2,2-dimethylpropanamide (CAS 188577-70-0) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: N-(4-chloro-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: HDLIWEMWMDOCHM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | N-(4-chloro-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | HDLIWEMWMDOCHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)