N-(4-Hydroxyphenyl)benzamide, 97%
cas: 15457-50-8 — see every product listed under this CAS number, including other names
N-(4-Hydroxyphenyl)benzamide, 97% (CAS 15457-50-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A231575-100mg |
| cas | 15457-50-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1071.25 Pln | |
| Ambeed | 5g | 2595.38 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 918.80 Pln | |
| Chemat | 5g | 2200.40 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 480.97 Pln | |
| BLDpharm | 1g | 1147.40 Pln | |
| BLDpharm | 5g | 2791.26 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 695.61 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
N-(4-hydroxyphenyl)benzamide (CAS 15457-50-8) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: N-(4-hydroxyphenyl)benzamide. InChIKey: CVPWYDXAVJCNAG-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)benzamide |
| InChIKey | CVPWYDXAVJCNAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)