cas: 915916-89-1 — see every product listed under this CAS number, including other names
N-(4-Methoxybenzyl)-N-methylbenzenesulfonamide 98% (CAS 915916-89-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245574-5g |
| cas | 915916-89-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2267.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A245574 |
N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide (CAS 915916-89-1) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide. InChIKey: MCUOPOJSLPOGIE-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide |
| InChIKey | MCUOPOJSLPOGIE-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)OC)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)