Products 1132649-21-8
CAS 1132649-21-8 is the registry number for 3-Butanoyl-1-tosylpyrrole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
1-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]butan-1-one (CAS 1132649-21-8) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: 1-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]butan-1-one. InChIKey: QZICTACJYTUCHC-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 1-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]butan-1-one |
| InChIKey | QZICTACJYTUCHC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=CN(C=C1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)