Products 571149-74-1
CAS 571149-74-1 appears in our catalog under these names: N-(4-Hydroxy-phenyl)-3,4,n-trimethyl-benzenesulfonamide, 95%, N-(4-Hydroxyphenyl)-N,3,4-trimethylbenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
N-(4-hydroxyphenyl)-N,3,4-trimethylbenzenesulfonamide (CAS 571149-74-1) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: N-(4-hydroxyphenyl)-N,3,4-trimethylbenzenesulfonamide. InChIKey: CLAVCJKSZDAUGR-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-N,3,4-trimethylbenzenesulfonamide |
| InChIKey | CLAVCJKSZDAUGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N(C)C2=CC=C(C=C2)O)C |
Computed by PubChem (NCBI)