CAS 116-41-6 appears in our catalog under these names: N-(2-Methoxy-5-methylphenyl)-4-methylbenzenesulfonamide, 95%, N–(2–methoxy–5–methylphenyl)–4–methylbenzenesulfonamid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
N-(2-methoxy-5-methylphenyl)-4-methylbenzenesulfonamide (CAS 116-41-6) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: N-(2-methoxy-5-methylphenyl)-4-methylbenzenesulfonamide. InChIKey: QDYAIVOXDZTGTJ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | N-(2-methoxy-5-methylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | QDYAIVOXDZTGTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC(=C2)C)OC |
Computed by PubChem (NCBI)