CAS 1365271-94-8 is the registry number for 2-(4-Methoxyphenyl)-N,N-dimethylbenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-methoxyphenyl)-N,N-dimethylbenzenesulfonamide (CAS 1365271-94-8) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-N,N-dimethylbenzenesulfonamide. InChIKey: IPYAFOBGBXTMHQ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | IPYAFOBGBXTMHQ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)