CAS 179103-95-8 is the registry number for 3-((4-(tert-Butyl)thiazol-2-yl)methoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzoic acid (CAS 179103-95-8) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: 3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzoic acid. InChIKey: GVPSPEDBRZFRFS-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzoic acid |
| InChIKey | GVPSPEDBRZFRFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC(=N1)COC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)