Products 179103-95-8

CAS 179103-95-8 is the registry number for 3-((4-(tert-Butyl)thiazol-2-yl)methoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzoic acid (CAS 179103-95-8) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: 3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzoic acid. InChIKey: GVPSPEDBRZFRFS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO3S
Molecular weight291.4 g/mol
IUPAC name3-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzoic acid
InChIKeyGVPSPEDBRZFRFS-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CSC(=N1)COC2=CC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)